CAS 135328-50-6
:2-(1H-Indol-7-yloxy)acetonitrile
Description:
2-(1H-Indol-7-yloxy)acetonitrile, with the CAS number 135328-50-6, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an acetonitrile functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the indole moiety suggests that it may exhibit biological activity, as indole derivatives are often found in pharmaceuticals and natural products. The compound is typically a solid at room temperature and may be soluble in organic solvents, depending on its specific structure and substituents. Its properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-5-7-13-9-3-1-2-8-4-6-12-10(8)9/h1-4,6,12H,7H2
InChI key:InChIKey=BFLZDIZKCIZTFL-UHFFFAOYSA-N
SMILES:O(CC#N)C1=C2C(C=CN2)=CC=C1
Synonyms:- (1H-indol-7-yloxy)acetonitrile
- 2-(1H-Indol-7-yloxy)acetonitrile
- 7-Cyanomethoxyindole
- Acetonitrile, (1H-indol-7-yloxy)-
- Acetonitrile, 2-(1H-indol-7-yloxy)-
- 7-(Cyanomethoxy)indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
7-(Cyanomethoxy)indole
CAS:7-(Cyanomethoxy)indole is a versatile building block that can be used as a precursor for the synthesis of various organic compounds. It can also be used as a research chemical, intermediate, and reaction component. 7-(Cyanomethoxy)indole is soluble in organic solvents such as acetone and ethanol, making it useful in many reactions. The compound is an excellent starting point for the synthesis of complex compounds with interesting biological activity. The compound has been shown to have high quality and purity, making it an ideal reagent for use in research.Formula:C10H8N2OMolecular weight:172.19 g/mol7-(Cyanomethoxy)indole
CAS:7-(Cyanomethoxy)indole is a versatile building block that can be used as a scaffold for the synthesis of complex molecules. It has been used as an intermediate in organic synthesis and as a reaction component for the preparation of useful compounds. 7-(Cyanomethoxy)indole is also known to have high quality and is widely used in research laboratories.
Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.18 g/mol
