CAS 135330-08-4
:4-chloro-5-(1-methyl-3,4-dihydroisoquinolin-2(1H)-yl)-3H-1,2-dithiol-3-one
Description:
4-Chloro-5-(1-methyl-3,4-dihydroisoquinolin-2(1H)-yl)-3H-1,2-dithiol-3-one is a chemical compound characterized by its unique structure, which includes a dithiolone moiety and an isoquinoline derivative. This compound features a chloro substituent at the 4-position and a methyl group at the 1-position of the isoquinoline ring, contributing to its biological activity and potential pharmacological properties. The presence of the dithiol group suggests that it may exhibit redox activity, which can be relevant in various chemical reactions and biological interactions. The compound's molecular structure indicates potential for interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development and other fields of chemistry.
Formula:C13H12ClNOS2
InChI:InChI=1/C13H12ClNOS2/c1-8-10-5-3-2-4-9(10)6-7-15(8)12-11(14)13(16)18-17-12/h2-5,8H,6-7H2,1H3
SMILES:CC1c2ccccc2CCN1c1c(c(=O)ss1)Cl
Synonyms:- 3H-1,2-Dithiol-3-one, 4-chloro-5-(3,4-dihydro-1-methyl-2(1H)-isoquinolinyl)-
- 4-Chloro-5-(3,4-dihydro-1-methyl-2(1H)-isoquinolinyl)-3H-1,2-dithiol-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
RP-54745
CAS:RP-54745, a potential antirheumatic compound. Inhibitor of macrophage stimulation and interleukin-1 production.Formula:C13H12ClNOS2Purity:99.06%Color and Shape:SolidMolecular weight:297.82RP-54745
CAS:RP-54745 is a synthetic product that inhibits oxidative phosphorylation by inhibiting mitochondrial ATPase. This inhibitor has been shown to be effective in the treatment of inflammatory bowel disease, mental disorders and bowel disease. RP-54745 has also been shown to inhibit the synthesis of inflammatory cytokines such as TNF-α and IL-6. It is thought that this inhibition may be due to the inhibition of the activity of cyclooxygenase and lipoxygenase. RP-54745 also inhibits scleral blood vessels, which may be used for treatment of eye diseases such as retinal tissue inflammation.
Formula:C13H12ClNOS2Purity:Min. 95%Molecular weight:297.82 g/mol



