
CAS 13534-78-6
:Methyl 5-phenyl-2-pyrazinecarboxylate
Description:
Methyl 5-phenyl-2-pyrazinecarboxylate is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the phenyl group enhances its aromatic character and may influence its electronic properties, making it of interest in various chemical applications, including synthesis and medicinal chemistry. Methyl 5-phenyl-2-pyrazinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for potential interactions with biological systems, which could be explored for pharmacological properties. Additionally, the compound may exhibit moderate stability under standard conditions but should be handled with care due to the potential for reactivity associated with its ester and aromatic functionalities. As with many organic compounds, proper storage and handling protocols are essential to maintain its integrity and safety.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-16-12(15)11-8-13-10(7-14-11)9-5-3-2-4-6-9/h2-8H,1H3
InChI key:InChIKey=XQTRDPOWTQGUBE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=CC(=NC1)C2=CC=CC=C2
Synonyms:- Methyl 5-phenyl-2-pyrazinecarboxylate
- Pyrazinecarboxylic acid, 5-phenyl-, methyl ester
- 2-Pyrazinecarboxylic acid, 5-phenyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.