CymitQuimica logo

CAS 1353497-16-1

:

Methyl 4-fluoro-α-[(2-hydroxyethyl)amino]benzeneacetate

Description:
Methyl 4-fluoro-α-[(2-hydroxyethyl)amino]benzeneacetate, identified by its CAS number 1353497-16-1, is a chemical compound characterized by its specific functional groups and structural features. It contains a methyl ester group, a fluoro-substituted aromatic ring, and a hydroxyethylamino moiety, which contribute to its potential biological activity and solubility properties. The presence of the fluorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. The hydroxyethylamino group may impart hydrophilicity, affecting the compound's pharmacokinetics and bioavailability. This compound may be of interest in medicinal chemistry and drug development due to its unique structure, which could lead to specific interactions with biological systems. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including esterification and substitution reactions. Overall, Methyl 4-fluoro-α-[(2-hydroxyethyl)amino]benzeneacetate represents a complex organic molecule with potential applications in pharmaceuticals or related fields.
Formula:C11H14FNO3
InChI:InChI=1S/C11H14FNO3/c1-16-11(15)10(13-6-7-14)8-2-4-9(12)5-3-8/h2-5,10,13-14H,6-7H2,1H3
InChI key:InChIKey=XGJQIYAPGDVAEA-UHFFFAOYSA-N
SMILES:C(NCCO)(C(OC)=O)C1=CC=C(F)C=C1
Synonyms:
  • Methyl 4-fluoro-α-[(2-hydroxyethyl)amino]benzeneacetate
  • Benzeneacetic acid, 4-fluoro-α-[(2-hydroxyethyl)amino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.