CymitQuimica logo

CAS 1353498-61-9

:

2-(3,5-Dimethylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxaldehyde

Description:
2-(3,5-Dimethylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxaldehyde is a complex organic compound characterized by its unique structural features, which include a pyrido[1,2-a]pyrimidine core, a carboxaldehyde functional group, and a phenoxy substituent. This compound typically exhibits a range of chemical properties, including potential reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions such as condensation and oxidation. The dimethylphenoxy group contributes to its hydrophobic character, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound's stability, reactivity, and potential applications in medicinal chemistry are areas of ongoing research, particularly in the context of developing new drugs or agrochemicals. Overall, this substance represents a fascinating example of synthetic organic chemistry with implications in various scientific fields.
Formula:C17H14N2O3
InChI:InChI=1S/C17H14N2O3/c1-11-7-12(2)9-13(8-11)22-16-14(10-20)17(21)19-6-4-3-5-15(19)18-16/h3-10H,1-2H3
InChI key:InChIKey=MLPNODZRLXVXHC-UHFFFAOYSA-N
SMILES:O(C1=C(C=O)C(=O)N2C(=N1)C=CC=C2)C3=CC(C)=CC(C)=C3
Synonyms:
  • 2-(3,5-Dimethylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxaldehyde
  • 4H-Pyrido[1,2-a]pyrimidine-3-carboxaldehyde, 2-(3,5-dimethylphenoxy)-4-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.