
CAS 135354-02-8
:Xaliproden
Description:
Xaliproden, with the CAS number 135354-02-8, is a chemical compound that has been studied primarily for its potential neuroprotective properties. It belongs to a class of compounds known as serotonin receptor agonists, which means it interacts with serotonin receptors in the brain, potentially influencing mood and cognitive functions. Xaliproden has been investigated for its effects on neurodegenerative diseases, particularly in the context of conditions like Alzheimer's disease and other forms of dementia. Its mechanism of action may involve modulation of neurotransmitter systems, promoting neuronal survival, and reducing apoptosis in neuronal cells. In terms of physical properties, specific data such as solubility, melting point, and stability under various conditions are essential for understanding its behavior in biological systems and potential therapeutic applications. However, detailed pharmacokinetic and toxicological profiles are crucial for assessing its safety and efficacy in clinical settings. Overall, Xaliproden represents a compound of interest in the field of neuropharmacology, warranting further research to fully elucidate its therapeutic potential.
Formula:C24H22F3N
InChI:InChI=1S/C24H22F3N/c25-24(26,27)23-7-3-6-22(17-23)20-11-14-28(15-12-20)13-10-18-8-9-19-4-1-2-5-21(19)16-18/h1-9,11,16-17H,10,12-15H2
InChI key:InChIKey=WJJYZXPHLSLMGE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C=2CCN(CCC3=CC4=C(C=C3)C=CC=C4)CC2
Synonyms:- Xaliproden
- 1-[2-(2-Naphthyl)ethyl]-4-(3-trifluoromethylphenyl)-1,2,3,6-tetrahydropyridine
- Pyridine, 1,2,3,6-tetrahydro-1-[2-(2-naphthalenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-
- 1,2,3,6-Tetrahydro-1-[2-(2-naphthalenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Xaliproden
CAS:Xaliproden is a biochemical.Formula:C24H22F3NColor and Shape:SolidMolecular weight:381.43
