CAS 1353553-07-7

2-Chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine

Description:

2-Chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine core, a chloro substituent, and a nitrophenoxy group. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of the chloro group can influence its reactivity and polarity, while the nitrophenoxy moiety may contribute to its electronic properties and potential interactions with biological targets. The compound is likely to be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the significance of thieno[3,2-d]pyrimidines in various therapeutic areas. Additionally, its unique structural features may impart specific pharmacological properties, making it a candidate for further investigation in the context of biological assays and structure-activity relationship studies. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₆ClN₃O₃S

InChI: InChI=1S/C12H6ClN3O3S/c13-12-14-9-4-5-20-10(9)11(15-12)19-8-3-1-2-7(6-8)16(17)18/h1-6H

InChI key: InChIKey=NZXIACCHHSKZIA-UHFFFAOYSA-N

SMILES: O(C1=C2C(=NC(Cl)=N1)C=CS2)C3=CC(N(=O)=O)=CC=C3

Synonyms:

• 2-Chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine
• Thieno[3,2-d]pyrimidine, 2-chloro-4-(3-nitrophenoxy)-

Thieno[3,2-d]pyrimidine, 2-chloro-4-(3-nitrophenoxy)-

CAS: 1353553-07-7

Formula: C₁₂H₆ClN₃O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 307.7123

Ref: IN-DA009XHF

2-chloro-4-(3-nitrophenoxy)thieno[3,2-d]pyrimidine

CAS: 1353553-07-7

Purity: 97.0%

Molecular weight: 307.7099914550781

Ref: 10-F519249