CAS 135357-25-4

(25R)-3,7,11,12,15,23-Hexaoxolanost-8-en-26-oic acid

Description:

(25R)-3,7,11,12,15,23-Hexaoxolanost-8-en-26-oic acid, identified by its CAS number 135357-25-4, is a complex organic compound characterized by its unique structural features, including multiple oxolane (tetrahydrofuran) rings and a steroid-like backbone. This compound belongs to a class of substances known as sterols, which are integral to various biological processes. Its structure suggests potential applications in biochemistry and pharmacology, particularly in the study of membrane dynamics and cellular signaling pathways. The presence of multiple oxygen-containing functional groups indicates that it may exhibit significant polarity, influencing its solubility and reactivity in biological systems. Additionally, the specific stereochemistry denoted by the (25R) configuration implies that it may interact selectively with biological receptors or enzymes, which could be relevant for therapeutic applications. Overall, this compound's intricate structure and functional groups position it as a subject of interest in both synthetic and natural product chemistry.

Formula: C₃₀H₃₈O₈

InChI: InChI=1S/C30H38O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17,19H,8-13H2,1-7H3,(H,37,38)/t14-,15-,17-,19+,28+,29+,30+/m1/s1

InChI key: InChIKey=AKWNYHCILPEENZ-YFIDGAHXSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])C(=O)C(=O)[C@]1(C)[C@@]([C@@H](CC(C[C@H](C(O)=O)C)=O)C)(CC2=O)[H]

Synonyms:

• Ganosporeric acid A
• Lanost-8-en-26-oic acid, 3,7,11,12,15,23-hexaoxo-, (25R)-
• (25R)-3,7,11,12,15,23-Hexaoxolanost-8-en-26-oic acid

Ganosporeric acid A

CAS: 135357-25-4

Formula: C₃₀H₃₈O₈

Molecular weight: 526.63

Ref: 7W-GY4770

Ganosporeric acid A

CAS: 135357-25-4

Formula: C₃₀H₃₈O₈

Purity: 95%~99%

Molecular weight: 526.626

Ref: BP-BP2170

Ganosporeric acid A

CAS: 135357-25-4

Ganosporeric acid A is a bioactive compound, which is a triterpenoid derived from the medicinal mushroom Ganoderma lucidum. This fungus has been traditionally used in Eastern medicine for its health-promoting properties. Ganosporeric acid A exhibits its mode of action primarily through modulation of various biological pathways, including anti-inflammatory, antioxidant, and immunomodulatory effects. It interacts with cellular signaling molecules and enzymes, potentially altering disease mechanisms at the molecular level.

Formula: C₃₀H₃₈O₈

Purity: Min. 95%

Molecular weight: 526.6 g/mol

Ref: 3D-KFA35725