CAS 1353636-73-3

1-(4-Fluorophenyl)-3-hydroxycyclobutanecarboxylic acid

Description:

1-(4-Fluorophenyl)-3-hydroxycyclobutanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, a hydroxyl group, and a carboxylic acid functional group. The presence of the 4-fluorophenyl substituent introduces both electron-withdrawing and steric effects, influencing the compound's reactivity and solubility. This compound is likely to exhibit moderate polarity due to the hydroxyl and carboxylic acid groups, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The cyclobutane ring contributes to the compound's rigidity, potentially affecting its conformational flexibility and biological activity. Additionally, the fluorine atom can impact the compound's lipophilicity and metabolic stability. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals where modifications to the aromatic system can lead to enhanced biological properties. Overall, 1-(4-Fluorophenyl)-3-hydroxycyclobutanecarboxylic acid represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₁₁H₁₁FO₃

InChI: InChI=1S/C11H11FO3/c12-8-3-1-7(2-4-8)11(10(14)15)5-9(13)6-11/h1-4,9,13H,5-6H2,(H,14,15)

InChI key: InChIKey=GLMOPVQMTLKNAR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC(O)C1)C2=CC=C(F)C=C2

Synonyms:

• 1-(4-Fluorophenyl)-3-hydroxycyclobutanecarboxylic acid
• Cyclobutanecarboxylic acid, 1-(4-fluorophenyl)-3-hydroxy-