CymitQuimica logo

CAS 135367-81-6

:

4-(P-dihexadecylaminostyryl)-N-*methylquinolinium

Description:
4-(P-dihexadecylaminostyryl)-N-methylquinolinium, identified by its CAS number 135367-81-6, is a synthetic organic compound characterized by its unique structure that combines a quinolinium moiety with a long-chain alkyl group. This compound typically exhibits amphiphilic properties due to the presence of both hydrophilic (the quinolinium part) and hydrophobic (the hexadecyl chains) components, which can influence its solubility in various solvents. It is often studied for its potential applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and as a fluorescent probe in biological systems. The presence of the long alkyl chains can enhance its self-assembly properties, making it suitable for forming micelles or other nanostructures. Additionally, the methyl group on the nitrogen atom contributes to the overall stability and electronic properties of the molecule. Overall, this compound is of interest in both academic research and potential industrial applications due to its unique chemical characteristics.
Formula:C50H82IN2
InChI:InChI=1/C50H81N2.HI/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-32-43-52(44-33-29-27-25-23-21-19-17-15-13-11-9-7-5-2)48-40-37-46(38-41-48)36-39-47-42-45-51(3)50-35-31-30-34-49(47)50;/h30-31,34-42,45H,4-29,32-33,43-44H2,1-3H3;1H/b39-36+;
Synonyms:
  • N,N-dihexadecyl-4-[(E)-2-(1-methyl-4-quinolyl)vinyl]aniline hydroiodide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.