CAS 1353776-70-1

5-Bromo-2-ethoxy-4-methoxypyrimidine

Description:

5-Bromo-2-ethoxy-4-methoxypyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at position 5 introduces a halogen substituent, enhancing the compound's reactivity and potential applications in various chemical reactions. The ethoxy group at position 2 and the methoxy group at position 4 contribute to the compound's solubility and polarity, making it suitable for use in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, which is often explored in drug development, particularly in the context of targeting specific enzymes or receptors. Its structural features suggest potential applications in agrochemicals or pharmaceuticals, where modifications to the pyrimidine core can lead to diverse biological activities. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and the potential for toxicity or environmental impact.

Formula: C₇H₉BrN₂O₂

InChI: InChI=1S/C7H9BrN2O2/c1-3-12-7-9-4-5(8)6(10-7)11-2/h4H,3H2,1-2H3

InChI key: InChIKey=OMDLUMHICPYGPL-UHFFFAOYSA-N

SMILES: O(C)C1=NC(OCC)=NC=C1Br

Synonyms:

• 5-Bromo-2-ethoxy-4-methoxypyrimidine
• Pyrimidine, 5-bromo-2-ethoxy-4-methoxy-