
CAS 1353777-43-1
:3-Bromo-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile
Description:
3-Bromo-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a bromine atom, a pyridine ring, and a cyano group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in organic synthesis. The cyclopropylmethoxy group contributes to the compound's steric and electronic properties, potentially affecting its interactions with biological targets or its solubility in various solvents. As a pyridine derivative, it may exhibit basicity due to the nitrogen atom in the ring, which can participate in hydrogen bonding and coordination with metal ions. The cyano group (-C≡N) is known for its electron-withdrawing properties, which can enhance the compound's reactivity in nucleophilic substitution reactions. Overall, the combination of these functional groups suggests that 3-Bromo-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c11-8-3-4-10(13-9(8)5-12)14-6-7-1-2-7/h3-4,7H,1-2,6H2
InChI key:InChIKey=XGLQIVDEXCKDRO-UHFFFAOYSA-N
SMILES:O(CC1CC1)C=2N=C(C#N)C(Br)=CC2
Synonyms:- 3-Bromo-6-(cyclopropylmethoxy)-2-pyridinecarbonitrile
- 3-Bromo-6-(cyclopropylmethoxy)pyridine-2-carbonitrile
- 2-Pyridinecarbonitrile, 3-bromo-6-(cyclopropylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.