CAS 13538-28-8

2-iodophenyl methylcarbamate

Description:

2-Iodophenyl methylcarbamate, with the CAS number 13538-28-8, is an organic compound characterized by its structure, which includes a phenyl ring substituted with an iodine atom and a carbamate functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the iodine atom can impart unique reactivity and properties, making it useful in synthetic chemistry. The methylcarbamate moiety contributes to its biological activity, as carbamates are often involved in enzyme inhibition and other biochemical interactions. Additionally, 2-iodophenyl methylcarbamate may exhibit specific solubility characteristics, depending on the solvent used, and its stability can be influenced by environmental factors such as temperature and pH. Safety data sheets should be consulted for handling and toxicity information, as compounds containing halogens and carbamate groups can pose health risks. Overall, this compound is of interest for its chemical properties and potential utility in research and industry.

Formula: C₈H₈INO₂

InChI: InChI=1/C8H8INO2/c1-10-8(11)12-7-5-3-2-4-6(7)9/h2-5H,1H3,(H,10,11)

SMILES: CN=C(O)Oc1ccccc1I

2-Iodophenyl Methylcarbamate

Controlled Product

CAS: 13538-28-8

Formula: C₈H₈INO₂

Color and Shape: Neat

Molecular weight: 277.059

Ref: TR-I737286