CAS 13538-60-8
:3-Bromophenol methylcarbamate
Description:
3-Bromophenol methylcarbamate, with the CAS number 13538-60-8, is an organic compound characterized by the presence of a bromine atom, a phenolic hydroxyl group, and a carbamate functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The bromine substituent on the phenolic ring can influence its reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. The methylcarbamate moiety contributes to its potential as a pesticide or herbicide, as carbamates are known for their ability to inhibit acetylcholinesterase, an important enzyme in nerve function. Additionally, the compound may exhibit antimicrobial or antifungal properties, which can be explored in agricultural or medicinal chemistry. Safety data should be consulted for handling and exposure risks, as compounds containing bromine and carbamate groups can pose health hazards. Overall, 3-Bromophenol methylcarbamate is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H8BrNO2
InChI:InChI=1/C8H8BrNO2/c1-10-8(11)12-7-4-2-3-6(9)5-7/h2-5H,1H3,(H,10,11)
SMILES:CN=C(O)Oc1cccc(c1)Br
Synonyms:- Phenol, 3-bromo-, methylcarbamate
- 3-Bromophenyl methylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromophenyl Methylcarbamate
CAS:Controlled ProductFormula:C8H8BrNO2Color and Shape:NeatMolecular weight:230.059
