CAS 1353855-94-3

4-Bromo-6-(tetrahydro-2H-pyran-4-yl)pyrimidine

Description:

4-Bromo-6-(tetrahydro-2H-pyran-4-yl)pyrimidine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with a bromine atom and a tetrahydro-2H-pyran moiety. The bromine substitution typically enhances the compound's reactivity, making it useful in various synthetic applications. The tetrahydro-2H-pyran group contributes to the compound's overall stability and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of both the bromine and the tetrahydro-pyran ring can influence the compound's physical properties, such as melting point, boiling point, and solubility. As with many heterocycles, the electronic properties of the pyrimidine ring can also play a significant role in its reactivity and interactions with other chemical species. Overall, 4-Bromo-6-(tetrahydro-2H-pyran-4-yl)pyrimidine is a versatile compound with potential applications in various fields of chemistry.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1S/C9H11BrN2O/c10-9-5-8(11-6-12-9)7-1-3-13-4-2-7/h5-7H,1-4H2

InChI key: InChIKey=JKOJLWSAKSFRED-UHFFFAOYSA-N

SMILES: BrC1=CC(=NC=N1)C2CCOCC2

Synonyms:

• 4-Bromo-6-(tetrahydro-2H-pyran-4-yl)pyrimidine
• Pyrimidine, 4-bromo-6-(tetrahydro-2H-pyran-4-yl)-