CymitQuimica logo

CAS 1353877-94-7

:

2-Bromo-6-(chloromethyl)-3-pyridinol

Description:
2-Bromo-6-(chloromethyl)-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with a bromine atom and a chloromethyl group, respectively. This compound features a hydroxyl group at the 3-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of halogen substituents (bromine and chlorine) enhances its electrophilic character, making it useful in nucleophilic substitution reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the compound's reactivity can be exploited in synthetic organic chemistry for the preparation of more complex molecules. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6H5BrClNO
InChI:InChI=1S/C6H5BrClNO/c7-6-5(10)2-1-4(3-8)9-6/h1-2,10H,3H2
InChI key:InChIKey=ZUHKZAVBOLRYJV-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(Br)C(O)=CC1
Synonyms:
  • 3-Pyridinol, 2-bromo-6-(chloromethyl)-
  • 2-Bromo-6-(chloromethyl)-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.