CAS 1353877-96-9
:Methyl 3-amino-6-chlorothieno[2,3-b][1,8]naphthyridine-2-carboxylate
Description:
Methyl 3-amino-6-chlorothieno[2,3-b][1,8]naphthyridine-2-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[2,3-b][1,8]naphthyridine core. This compound features a methyl ester functional group, an amino group, and a chlorine substituent, contributing to its potential reactivity and biological activity. The presence of the thieno and naphthyridine moieties suggests that it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, potentially influencing its solubility, stability, and bioavailability. The compound's CAS number, 1353877-96-9, serves as a unique identifier, facilitating its identification in chemical databases and literature. Overall, Methyl 3-amino-6-chlorothieno[2,3-b][1,8]naphthyridine-2-carboxylate represents a class of compounds that may have applications in drug development and other fields of chemical research.
Formula:C12H8ClN3O2S
InChI:InChI=1S/C12H8ClN3O2S/c1-18-12(17)9-8(14)7-3-5-2-6(13)4-15-10(5)16-11(7)19-9/h2-4H,14H2,1H3
InChI key:InChIKey=PFFZGLXRMCBFRX-UHFFFAOYSA-N
SMILES:NC=1C=2C(SC1C(OC)=O)=NC=3C(C2)=CC(Cl)=CN3
Synonyms:- Thieno[2,3-b][1,8]naphthyridine-2-carboxylic acid, 3-amino-6-chloro-, methyl ester
- Methyl 3-amino-6-chlorothieno[2,3-b][1,8]naphthyridine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 3-amino-6-chlorothieno[2,3-b]1,8-naphthyridine-2-carboxylate
CAS:<p>Methyl 3-amino-6-chlorothieno[2,3-b]1,8-naphthyridine-2-carboxylate</p>Molecular weight:293.73g/mol
