CAS 1353878-07-5

Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide

Description:

Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide, identified by its CAS number 1353878-07-5, is a heterocyclic organic compound featuring a fused benzothiophene structure. This compound is characterized by the presence of a hydroxyl group (-OH) at the 3-position and a chlorine atom at the 5-position of the benzothiophene ring. The "1,1-dioxide" designation indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiophene ring, which contributes to its chemical reactivity and stability. The compound is likely to exhibit properties typical of both aromatic and thiophene derivatives, including potential biological activity due to the presence of the hydroxyl group. Its unique structure may influence its solubility, melting point, and reactivity with other chemical species. Such compounds are often of interest in medicinal chemistry and materials science, where their electronic properties and potential applications in pharmaceuticals or as intermediates in organic synthesis can be explored.

Formula: C₈H₇ClO₃S

InChI: InChI=1S/C8H7ClO3S/c9-5-1-2-8-6(3-5)7(10)4-13(8,11)12/h1-3,7,10H,4H2

InChI key: InChIKey=RKSPUXNPAQVIRM-UHFFFAOYSA-N

SMILES: OC1C=2C(S(=O)(=O)C1)=CC=C(Cl)C2

Synonyms:

• Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide

5-Chloro-2,3-dihydro-1-benzothiophene-3-ol 1,1-dioxide

CAS: 1353878-07-5

5-Chloro-2,3-dihydro-1-benzothiophene-3-ol 1,1-dioxide

Molecular weight: 218.66g/mol

Ref: 54-OR303976