CAS 1353878-07-5
:Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide
Description:
Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide, identified by its CAS number 1353878-07-5, is a heterocyclic organic compound featuring a fused benzothiophene structure. This compound is characterized by the presence of a hydroxyl group (-OH) at the 3-position and a chlorine atom at the 5-position of the benzothiophene ring. The "1,1-dioxide" designation indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiophene ring, which contributes to its chemical reactivity and stability. The compound is likely to exhibit properties typical of both aromatic and thiophene derivatives, including potential biological activity due to the presence of the hydroxyl group. Its unique structure may influence its solubility, melting point, and reactivity with other chemical species. Such compounds are often of interest in medicinal chemistry and materials science, where their electronic properties and potential applications in pharmaceuticals or as intermediates in organic synthesis can be explored.
Formula:C8H7ClO3S
InChI:InChI=1S/C8H7ClO3S/c9-5-1-2-8-6(3-5)7(10)4-13(8,11)12/h1-3,7,10H,4H2
InChI key:InChIKey=RKSPUXNPAQVIRM-UHFFFAOYSA-N
SMILES:OC1C=2C(S(=O)(=O)C1)=CC=C(Cl)C2
Synonyms:- Benzo[b]thiophene-3-ol, 5-chloro-2,3-dihydro-, 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloro-2,3-dihydro-1-benzothiophene-3-ol 1,1-dioxide
CAS:5-Chloro-2,3-dihydro-1-benzothiophene-3-ol 1,1-dioxide
Molecular weight:218.66g/mol
