CAS 1353878-09-7
:7-Hydroxy-4-[[4-(hydroxymethyl)-1-piperidinyl]methyl]-2H-1-benzopyran-2-one
Description:
7-Hydroxy-4-[[4-(hydroxymethyl)-1-piperidinyl]methyl]-2H-1-benzopyran-2-one, with the CAS number 1353878-09-7, is a synthetic organic compound characterized by its complex structure that includes a benzopyran moiety and a piperidine ring. This compound features multiple functional groups, including hydroxyl groups, which contribute to its potential biological activity. The presence of the hydroxymethyl group on the piperidine enhances its solubility and reactivity, making it of interest in medicinal chemistry. The benzopyran structure is known for its role in various pharmacological activities, including antioxidant and anti-inflammatory properties. The compound's unique arrangement of atoms suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C16H19NO4
InChI:InChI=1S/C16H19NO4/c18-10-11-3-5-17(6-4-11)9-12-7-16(20)21-15-8-13(19)1-2-14(12)15/h1-2,7-8,11,18-19H,3-6,9-10H2
InChI key:InChIKey=JOKJIQGQZNJJBS-UHFFFAOYSA-N
SMILES:C(C=1C=2C(OC(=O)C1)=CC(O)=CC2)N3CCC(CO)CC3
Synonyms:- 2H-1-Benzopyran-2-one, 7-hydroxy-4-[[4-(hydroxymethyl)-1-piperidinyl]methyl]-
- 7-Hydroxy-4-[[4-(hydroxymethyl)-1-piperidinyl]methyl]-2H-1-benzopyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Hydroxy-4-{[4-(hydroxymethyl)piperidin-1-yl]methyl}-2H-chromen-2-one
CAS:7-Hydroxy-4-{[4-(hydroxymethyl)piperidin-1-yl]methyl}-2H-chromen-2-one
Molecular weight:289.33g/mol
