CAS 1353878-11-1
:3-(3,4-Dimethoxyphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one
Description:
3-(3,4-Dimethoxyphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one is a chemical compound characterized by its unique spirocyclic structure, which includes a combination of nitrogen and oxygen heteroatoms. The presence of the 3,4-dimethoxyphenyl group contributes to its potential biological activity, as methoxy groups can enhance lipophilicity and influence interactions with biological targets. The compound features a diazaspiro framework, which may impart interesting conformational properties and stability. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. The compound's CAS number, 1353878-11-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses. As with many organic compounds, its solubility, reactivity, and stability will depend on the specific conditions under which it is handled, including solvent choice and temperature. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in various fields.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-19-12-4-3-11(9-13(12)20-2)17-10-15(21-14(17)18)5-7-16-8-6-15/h3-4,9,16H,5-8,10H2,1-2H3
InChI key:InChIKey=IGUPZHNAAXMRJJ-UHFFFAOYSA-N
SMILES:O=C1OC2(CN1C3=CC(OC)=C(OC)C=C3)CCNCC2
Synonyms:- 3-(3,4-Dimethoxyphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one
- 1-Oxa-3,8-diazaspiro[4.5]decan-2-one, 3-(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3,4-Dimethoxyphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one
CAS:3-(3,4-Dimethoxyphenyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one
Molecular weight:292.33g/mol
