CAS 1353878-19-9
:1,1-Dimethylethyl N-(3-iodo-5-nitrophenyl)carbamate
Description:
1,1-Dimethylethyl N-(3-iodo-5-nitrophenyl)carbamate, identified by its CAS number 1353878-19-9, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This specific compound includes a dimethyl group, contributing to its steric bulk, and a nitrophenyl moiety that introduces both electron-withdrawing and potential reactivity due to the presence of the nitro group. The iodine atom in the structure enhances the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The presence of these functional groups suggests that the compound may exhibit interesting biological activities, possibly as a pesticide or pharmaceutical intermediate. Its solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature, making it essential to consider these factors in practical applications.
Formula:C11H13IN2O4
InChI:InChI=1S/C11H13IN2O4/c1-11(2,3)18-10(15)13-8-4-7(12)5-9(6-8)14(16)17/h4-6H,1-3H3,(H,13,15)
InChI key:InChIKey=WYGVIKBMRWQNJH-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=CC(N(=O)=O)=CC(I)=C1
Synonyms:- 1,1-Dimethylethyl N-(3-iodo-5-nitrophenyl)carbamate
- Carbamic acid, N-(3-iodo-5-nitrophenyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl N-(3-iodo-5-nitrophenyl)carbamate
CAS:tert-Butyl N-(3-iodo-5-nitrophenyl)carbamate
Molecular weight:364.14g/mol
