CymitQuimica logo

CAS 1353878-22-4

:

2-Fluoro-4-(4-methyl-1H-1,2,3-triazol-1-yl)benzenamine

Description:
2-Fluoro-4-(4-methyl-1H-1,2,3-triazol-1-yl)benzenamine is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a triazole ring. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The triazole moiety, a five-membered ring containing three nitrogen atoms, is known for its role in various biological applications, including as a building block in pharmaceuticals and agrochemicals. This compound may exhibit properties such as antimicrobial or antifungal activity due to the triazole group. Additionally, the amine functional group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many compounds containing heterocycles and halogens, careful consideration of its synthesis, stability, and reactivity is essential for practical applications.
Formula:C9H9FN4
InChI:InChI=1S/C9H9FN4/c1-6-5-14(13-12-6)7-2-3-9(11)8(10)4-7/h2-5H,11H2,1H3
InChI key:InChIKey=AVBBVLZILINETH-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1N)N2C=C(C)N=N2
Synonyms:
  • 2-Fluoro-4-(4-methyl-1H-1,2,3-triazol-1-yl)benzenamine
  • Benzenamine, 2-fluoro-4-(4-methyl-1H-1,2,3-triazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.