CymitQuimica logo

CAS 1353878-27-9

:

rel-4-[[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl]-7-hydroxy-2H-1-benzopyran-2-one

Description:
The chemical substance known as rel-4-[[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl]-7-hydroxy-2H-1-benzopyran-2-one, with the CAS number 1353878-27-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzopyran core, a hydroxyl group, and a morpholine moiety. This compound typically exhibits properties associated with flavonoids, such as antioxidant activity, and may interact with various biological pathways due to its structural features. The presence of the morpholine ring suggests potential for solubility in polar solvents, while the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and biological interactions. Its stereochemistry, indicated by the (2R,6S) configuration, may also play a crucial role in its pharmacological profile, affecting how it interacts with biological targets. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C16H19NO4
InChI:InChI=1/C16H19NO4/c1-10-7-17(8-11(2)20-10)9-12-5-16(19)21-15-6-13(18)3-4-14(12)15/h3-6,10-11,18H,7-9H2,1-2H3/t10-,11+
InChI key:InChIKey=WEQLMQPMEKVDJT-PHIMTYICNA-N
SMILES:C(C=1C=2C(OC(=O)C1)=CC(O)=CC2)N3C[C@H](C)O[C@H](C)C3
Synonyms:
  • 2H-1-Benzopyran-2-one, 4-[[(2R,6S)-2,6-dimethyl-4-morpholinyl]methyl]-7-hydroxy-, rel-
  • rel-4-[[(2R,6S)-2,6-Dimethyl-4-morpholinyl]methyl]-7-hydroxy-2H-1-benzopyran-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.