CAS 13539-13-4
:2,5-bis(octyldithio)-1,3,4-thiadiazole
Description:
2,5-bis(octyldithio)-1,3,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and two octyldithio substituents. This compound belongs to the class of heterocyclic compounds, specifically thiadiazoles, which are known for their diverse applications in materials science and organic electronics. The presence of the octyldithio groups enhances its solubility in organic solvents and may contribute to its electronic properties, making it potentially useful in the development of conductive polymers or as a building block in organic semiconductors. The compound exhibits stability under ambient conditions, although its reactivity can vary depending on the presence of functional groups or environmental factors. Additionally, its molecular structure suggests potential interactions with other materials, which could be exploited in various applications, including sensors, photovoltaic devices, and other electronic components. As with many thiadiazole derivatives, it may also exhibit interesting photophysical properties, making it a subject of interest in research and development within the field of organic chemistry and materials science.
Formula:C18H34N2S5
InChI:InChI=1/C18H34N2S5/c1-3-5-7-9-11-13-15-21-24-17-19-20-18(23-17)25-22-16-14-12-10-8-6-4-2/h3-16H2,1-2H3
InChI key:InChIKey=ZFOMEJJNWNWWIB-UHFFFAOYSA-N
SMILES:S(SCCCCCCCC)C=1SC(SSCCCCCCCC)=NN1
Synonyms:- 1,3,4-Thiadiazole, 2,5-Bis(Octyldithio)-
- 2,5-Bis(n-octyldithio)thiadiazole
- 2,5-Bis(octyldisulfanyl)-1,3,4-thiadiazole
- 236-912-2
- 2,5-Bis(octyldithio)-1,3,4-thiadiazole
- new Metallic passivator antioxidant
- 2,5-Bis(octyldithio)-1,3,4-thiadiazole TH561
- 2,5-BIS(N-OCTYLDITHIO)-1,3,4-THIADIAZOLE
- TH561
- 2,5-DiMercaptothiadiazole derivative
- as cuvan 826
- Einecs 236-912-2
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.