CAS 1353943-47-1
:Methyl 1-acetyl-4-(2-chloroacetyl)-2-piperazinecarboxylate
Description:
Methyl 1-acetyl-4-(2-chloroacetyl)-2-piperazinecarboxylate is a synthetic organic compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features multiple functional groups, including an acetyl group and a chloroacetyl group, which contribute to its reactivity and potential biological activity. The presence of the methyl ester group indicates that it can undergo hydrolysis, making it relevant in various chemical reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety's known activity in drug design. The chloroacetyl group may enhance its electrophilic properties, allowing for further derivatization. Additionally, the compound's solubility and stability can be influenced by the presence of these functional groups, making it a subject of interest for researchers exploring new therapeutic agents or chemical intermediates. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity associated with the chloroacetyl group.
Formula:C10H15ClN2O4
InChI:InChI=1S/C10H15ClN2O4/c1-7(14)13-4-3-12(9(15)5-11)6-8(13)10(16)17-2/h8H,3-6H2,1-2H3
InChI key:InChIKey=ZUQOUXUNPQJUOL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1N(C(C)=O)CCN(C(CCl)=O)C1
Synonyms:- Methyl 1-acetyl-4-(2-chloroacetyl)-2-piperazinecarboxylate
- 2-Piperazinecarboxylic acid, 1-acetyl-4-(2-chloroacetyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.