CAS 1353943-59-5
:2-Amino-N-cyclopropyl-N-[(6-methoxy-3-pyridazinyl)methyl]acetamide
Description:
2-Amino-N-cyclopropyl-N-[(6-methoxy-3-pyridazinyl)methyl]acetamide is a chemical compound characterized by its unique structural features, which include an amino group, a cyclopropyl moiety, and a pyridazine ring substituted with a methoxy group. This compound is typically classified as an amide due to the presence of the acetamide functional group. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The presence of the cyclopropyl group may contribute to its conformational rigidity, potentially influencing its interaction with biological targets. The methoxy substitution on the pyridazine ring can enhance lipophilicity and may affect the compound's solubility and permeability. Additionally, the compound's specific stereochemistry and functional groups can play a crucial role in its reactivity and interaction with enzymes or receptors. Overall, 2-Amino-N-cyclopropyl-N-[(6-methoxy-3-pyridazinyl)methyl]acetamide represents a complex organic molecule with potential applications in medicinal chemistry and drug development.
Formula:C11H16N4O2
InChI:InChI=1S/C11H16N4O2/c1-17-10-5-2-8(13-14-10)7-15(9-3-4-9)11(16)6-12/h2,5,9H,3-4,6-7,12H2,1H3
InChI key:InChIKey=VYEQYANDTZUINK-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(OC)N=N1)(C(CN)=O)C2CC2
Synonyms:- Acetamide, 2-amino-N-cyclopropyl-N-[(6-methoxy-3-pyridazinyl)methyl]-
- 2-Amino-N-cyclopropyl-N-[(6-methoxy-3-pyridazinyl)methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.