CAS 1353943-61-9
:N-[1-(2-Aminoacetyl)-3-pyrrolidinyl]-N-ethylacetamide
Description:
N-[1-(2-Aminoacetyl)-3-pyrrolidinyl]-N-ethylacetamide, identified by its CAS number 1353943-61-9, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of an acetamide functional group, which contributes to its potential biological activity. The aminoacetyl moiety suggests that it may participate in various biochemical interactions, possibly influencing protein synthesis or enzyme activity. The ethyl group attached to the nitrogen atom indicates that it may exhibit lipophilic properties, potentially affecting its solubility and permeability in biological systems. Such structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Its specific interactions and effects would depend on its conformation and the presence of other functional groups, making it a candidate for further research in drug development and therapeutic applications.
Formula:C10H19N3O2
InChI:InChI=1S/C10H19N3O2/c1-3-13(8(2)14)9-4-5-12(7-9)10(15)6-11/h9H,3-7,11H2,1-2H3
InChI key:InChIKey=CBGGUHZKLZVKKG-UHFFFAOYSA-N
SMILES:N(C(C)=O)(CC)C1CN(C(CN)=O)CC1
Synonyms:- Acetamide, N-[1-(2-aminoacetyl)-3-pyrrolidinyl]-N-ethyl-
- N-[1-(2-Aminoacetyl)-3-pyrrolidinyl]-N-ethylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.