CAS 1353943-64-2
:N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-ethylacetamide
Description:
N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-ethylacetamide, identified by its CAS number 1353943-64-2, is a chemical compound that features a piperidine ring, which is a six-membered ring containing one nitrogen atom. This compound is characterized by the presence of an ethyl group and an acetamide functional group, contributing to its potential biological activity. The aminoacetyl moiety suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or exhibiting pharmacological properties. Its structure indicates that it may be soluble in polar solvents, typical for amides, and it may exhibit basic properties due to the nitrogen in the piperidine ring. The presence of functional groups such as the amine and acetamide suggests potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C11H21N3O2
InChI:InChI=1S/C11H21N3O2/c1-3-14(9(2)15)10-4-6-13(7-5-10)11(16)8-12/h10H,3-8,12H2,1-2H3
InChI key:InChIKey=SNRJIDJSNZOEKE-UHFFFAOYSA-N
SMILES:N(C(C)=O)(CC)C1CCN(C(CN)=O)CC1
Synonyms:- N-[1-(2-Aminoacetyl)-4-piperidinyl]-N-ethylacetamide
- Acetamide, N-[1-(2-aminoacetyl)-4-piperidinyl]-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.