CAS 1353943-72-2

N-Cyclopropyl-N-[2-(methylamino)cyclohexyl]acetamide

Description:

N-Cyclopropyl-N-[2-(methylamino)cyclohexyl]acetamide, identified by its CAS number 1353943-72-2, is a chemical compound that belongs to the class of amides. This substance features a cyclopropyl group and a cyclohexyl moiety, which contribute to its unique structural characteristics and potential biological activity. The presence of a methylamino group suggests that it may exhibit interactions with biological targets, potentially influencing neurotransmitter systems. The acetamide functional group indicates that it may participate in hydrogen bonding, affecting its solubility and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not universally available, compounds of this nature often exhibit moderate to high lipophilicity, which can influence their pharmacokinetic profiles. Additionally, the structural complexity may suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₂₂N₂O

InChI: InChI=1S/C12H22N2O/c1-9(15)14(10-7-8-10)12-6-4-3-5-11(12)13-2/h10-13H,3-8H2,1-2H3

InChI key: InChIKey=MRMFGOPARWXEPW-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C1C(NC)CCCC1)C2CC2

Synonyms:

• N-Cyclopropyl-N-[2-(methylamino)cyclohexyl]acetamide
• Acetamide, N-cyclopropyl-N-[2-(methylamino)cyclohexyl]-