CAS 1353943-82-4
:4-[(Acetylamino)methyl]-1-piperidineacetic acid
Description:
4-[(Acetylamino)methyl]-1-piperidineacetic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an acetylamino group, indicating the presence of an acetyl group attached to an amino group, contributing to its potential biological activity. The acetic acid moiety suggests that it possesses acidic properties, which may influence its solubility and reactivity in various environments. The presence of both the piperidine and acetic acid functionalities indicates that this compound may exhibit interesting pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its molecular structure allows for various interactions, including hydrogen bonding and steric effects, which can be critical in drug design and development. Additionally, the compound's specific stereochemistry and functional groups may play a significant role in its biological activity and therapeutic potential. Overall, 4-[(Acetylamino)methyl]-1-piperidineacetic acid is a compound of interest in medicinal chemistry and pharmacology.
Formula:C10H18N2O3
InChI:InChI=1S/C10H18N2O3/c1-8(13)11-6-9-2-4-12(5-3-9)7-10(14)15/h9H,2-7H2,1H3,(H,11,13)(H,14,15)
InChI key:InChIKey=JOUTZDSHDJNVMA-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCC(CNC(C)=O)CC1
Synonyms:- 4-[(Acetylamino)methyl]-1-piperidineacetic acid
- 1-Piperidineacetic acid, 4-[(acetylamino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.