CymitQuimica logo

CAS 1353944-48-5

:

N-[2-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide

Description:
N-[2-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide, identified by its CAS number 1353944-48-5, is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in medicinal chemistry. The structure features a cyclohexyl ring, which contributes to its hydrophobic properties, while the ethyl and hydroxyethyl substituents enhance its solubility in polar solvents. This compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of drugs that require specific interactions with biological systems. Additionally, the presence of the hydroxyethyl group may impart additional stability and solubility, making it a candidate for further research in drug formulation. Overall, the characteristics of this compound highlight its relevance in the fields of organic chemistry and pharmacology.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-3-14(8-9-15)12-7-5-4-6-11(12)13-10(2)16/h11-12,15H,3-9H2,1-2H3,(H,13,16)
InChI key:InChIKey=HCOCTCQWVBEJKU-UHFFFAOYSA-N
SMILES:N(CCO)(CC)C1C(NC(C)=O)CCCC1
Synonyms:
  • N-[2-[Ethyl(2-hydroxyethyl)amino]cyclohexyl]acetamide
  • Acetamide, N-[2-[ethyl(2-hydroxyethyl)amino]cyclohexyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.