CAS 1353944-86-1

2-Amino-1-[3-[ethyl(phenylmethyl)amino]-1-piperidinyl]ethanone

Description:

2-Amino-1-[3-[ethyl(phenylmethyl)amino]-1-piperidinyl]ethanone, with the CAS number 1353944-86-1, is a chemical compound characterized by its complex structure, which includes an amino group, a piperidine ring, and an ethanone moiety. This compound is typically classified as an organic amine due to the presence of the amino functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to neurotransmitter modulation or receptor interaction. The presence of both ethyl and phenylmethyl substituents indicates that it may possess lipophilic properties, which can influence its pharmacokinetics and bioavailability. Additionally, the piperidine ring contributes to its conformational flexibility, potentially affecting its interaction with biological targets. As with many organic compounds, the specific characteristics such as solubility, melting point, and reactivity would depend on the compound's purity and the conditions under which it is studied. Safety and handling precautions should be observed due to the potential biological activity of such compounds.

Formula: C₁₆H₂₅N₃O

InChI: InChI=1S/C16H25N3O/c1-2-18(12-14-7-4-3-5-8-14)15-9-6-10-19(13-15)16(20)11-17/h3-5,7-8,15H,2,6,9-13,17H2,1H3

InChI key: InChIKey=ATQPZMKWHFWLKT-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC)C2CN(C(CN)=O)CCC2

Synonyms:

• Ethanone, 2-amino-1-[3-[ethyl(phenylmethyl)amino]-1-piperidinyl]-
• 2-Amino-1-[3-[ethyl(phenylmethyl)amino]-1-piperidinyl]ethanone