CymitQuimica logo

CAS 1353945-07-9

:

2-Amino-N-methyl-N-[(1-methyl-3-piperidinyl)methyl]acetamide

Description:
2-Amino-N-methyl-N-[(1-methyl-3-piperidinyl)methyl]acetamide, identified by its CAS number 1353945-07-9, is a chemical compound characterized by its amide functional group, which includes an amino group and a methylated piperidine moiety. This compound typically exhibits properties associated with amines and amides, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and organic solvents. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the amino and methyl groups, which may affect its pharmacokinetic properties. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.
Formula:C10H21N3O
InChI:InChI=1S/C10H21N3O/c1-12-5-3-4-9(7-12)8-13(2)10(14)6-11/h9H,3-8,11H2,1-2H3
InChI key:InChIKey=XREDZAXVIXZFQG-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C)C1CN(C)CCC1
Synonyms:
  • 2-Amino-N-methyl-N-[(1-methyl-3-piperidinyl)methyl]acetamide
  • Acetamide, 2-amino-N-methyl-N-[(1-methyl-3-piperidinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.