CymitQuimica logo

CAS 1353945-10-4

:

N-[[1-(2-Hydroxyethyl)-2-pyrrolidinyl]methyl]-N-methylacetamide

Description:
N-[[1-(2-Hydroxyethyl)-2-pyrrolidinyl]methyl]-N-methylacetamide, identified by its CAS number 1353945-10-4, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a hydroxyl group. This compound typically exhibits properties associated with amides, such as moderate polarity and potential solubility in polar solvents. The presence of the hydroxyl group contributes to its hydrophilicity, while the pyrrolidine moiety may influence its biological activity and interaction with various receptors or enzymes. It may be utilized in pharmaceutical applications due to its structural features, which can enhance bioavailability or target specificity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-[[1-(2-Hydroxyethyl)-2-pyrrolidinyl]methyl]-N-methylacetamide represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-9(14)11(2)8-10-4-3-5-12(10)6-7-13/h10,13H,3-8H2,1-2H3
InChI key:InChIKey=SBXJFFINGQSLJG-UHFFFAOYSA-N
SMILES:C(N(C(C)=O)C)C1N(CCO)CCC1
Synonyms:
  • Acetamide, N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]-N-methyl-
  • N-[[1-(2-Hydroxyethyl)-2-pyrrolidinyl]methyl]-N-methylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.