CAS 1353945-19-3
:N<sup>1</sup>-(2-Aminoethyl)-N<sup>1</sup>-cyclopropyl-N<sup>4</sup>,N<sup>4</sup>-dimethyl-1,4-cyclohexanediamine
Description:
N1-(2-Aminoethyl)-N1-cyclopropyl-N4,N4-dimethyl-1,4-cyclohexanediamine, identified by its CAS number 1353945-19-3, is a chemical compound characterized by its complex structure featuring a cyclohexane backbone with multiple amine functional groups. This compound contains both cyclopropyl and dimethyl substituents, which contribute to its unique steric and electronic properties. It is likely to exhibit basicity due to the presence of amine groups, making it potentially useful in various chemical reactions, including those involving nucleophilic substitution. The presence of the aminoethyl chain may enhance its solubility in polar solvents, while the cyclopropyl group can influence its reactivity and interaction with biological targets. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H27N3
InChI:InChI=1S/C13H27N3/c1-15(2)11-3-5-12(6-4-11)16(10-9-14)13-7-8-13/h11-13H,3-10,14H2,1-2H3
InChI key:InChIKey=NLGHULVJSHLZHJ-UHFFFAOYSA-N
SMILES:N(CCN)(C1CC1)C2CCC(N(C)C)CC2
Synonyms:- N1-(2-Aminoethyl)-N1-cyclopropyl-N4,N4-dimethyl-1,4-cyclohexanediamine
- 1,4-Cyclohexanediamine, N1-(2-aminoethyl)-N1-cyclopropyl-N4,N4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.