CAS 1353945-54-6
:N2-Cyclopropyl-3-methyl-1,2-benzenediamine
Description:
N2-Cyclopropyl-3-methyl-1,2-benzenediamine, identified by its CAS number 1353945-54-6, is an organic compound characterized by its unique molecular structure, which includes a cyclopropyl group and a 1,2-benzenediamine framework. This compound features two amine (-NH2) functional groups attached to a benzene ring, which contributes to its potential reactivity and ability to form hydrogen bonds. The presence of the cyclopropyl group introduces strain and can influence the compound's physical and chemical properties, such as its boiling point, solubility, and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. As with many amines, it may also be basic and can participate in various chemical reactions, including alkylation and acylation, making it a versatile building block in organic synthesis.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-7-3-2-4-9(11)10(7)12-8-5-6-8/h2-4,8,12H,5-6,11H2,1H3
InChI key:InChIKey=VFPMRRVWRGVTMJ-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=CC=C1N)C2CC2
Synonyms:- N2-Cyclopropyl-3-methyl-1,2-benzenediamine
- 2-N-Cyclopropyl-3-methylbenzene-1,2-diamine
- 1,2-Benzenediamine, N2-cyclopropyl-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.