CAS 1353945-60-4
:N-[1-(2-Aminoethyl)-4-piperidinyl]-N-cyclopropylacetamide
Description:
N-[1-(2-Aminoethyl)-4-piperidinyl]-N-cyclopropylacetamide, identified by its CAS number 1353945-60-4, is a chemical compound characterized by its structural features that include a piperidine ring and a cyclopropyl group. This compound typically exhibits properties associated with amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of both amino and carbonyl functional groups. The piperidine moiety contributes to its basicity, while the cyclopropyl group may influence its steric and electronic properties, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Its unique structure suggests potential applications in various therapeutic areas, although specific biological activities and mechanisms would require further investigation through experimental studies. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C12H23N3O
InChI:InChI=1S/C12H23N3O/c1-10(16)15(11-2-3-11)12-4-7-14(8-5-12)9-6-13/h11-12H,2-9,13H2,1H3
InChI key:InChIKey=KKWXJIGAHOBQFU-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C1CC1)C2CCN(CCN)CC2
Synonyms:- N-[1-(2-Aminoethyl)-4-piperidinyl]-N-cyclopropylacetamide
- Acetamide, N-[1-(2-aminoethyl)-4-piperidinyl]-N-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.