CymitQuimica logo

CAS 1353945-71-7

:

N-[1-(2-Chloroacetyl)-3-piperidinyl]-N-ethylacetamide

Description:
N-[1-(2-Chloroacetyl)-3-piperidinyl]-N-ethylacetamide, identified by its CAS number 1353945-71-7, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a chloroacetyl group and an ethylacetamide moiety, contributing to its potential biological activity. The chloroacetyl group can enhance reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The piperidine structure is known for its role in various pharmacological applications, often exhibiting properties such as analgesic or anxiolytic effects. The compound's molecular structure suggests it may interact with biological targets, potentially influencing neurotransmitter systems. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions are essential, particularly due to the presence of the chloroacetyl group, which can be hazardous. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C11H19ClN2O2
InChI:InChI=1S/C11H19ClN2O2/c1-3-14(9(2)15)10-5-4-6-13(8-10)11(16)7-12/h10H,3-8H2,1-2H3
InChI key:InChIKey=QQHXQYSDCHABOT-UHFFFAOYSA-N
SMILES:N(C(C)=O)(CC)C1CN(C(CCl)=O)CCC1
Synonyms:
  • Acetamide, N-[1-(2-chloroacetyl)-3-piperidinyl]-N-ethyl-
  • N-[1-(2-Chloroacetyl)-3-piperidinyl]-N-ethylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.