CAS 1353945-74-0
:1,1-Dimethylethyl 2-[[(4-chlorophenyl)sulfonyl]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-[[(4-chlorophenyl)sulfonyl]methyl]-1-pyrrolidinecarboxylate, with the CAS number 1353945-74-0, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a sulfonyl group, and a tert-butyl substituent. This compound typically exhibits properties associated with both organic and medicinal chemistry, making it of interest in pharmaceutical research. The presence of the 4-chlorophenyl group suggests potential biological activity, as halogenated aromatic compounds often interact with biological targets. The sulfonyl moiety can enhance solubility and stability, while the pyrrolidine ring may contribute to the compound's ability to engage in various chemical reactions. Additionally, the tert-butyl group can influence the steric hindrance and lipophilicity of the molecule, affecting its pharmacokinetic properties. Overall, this compound's unique structural features may provide insights into its potential applications in drug development or as a chemical intermediate in synthetic processes.
Formula:C16H22ClNO4S
InChI:InChI=1S/C16H22ClNO4S/c1-16(2,3)22-15(19)18-10-4-5-13(18)11-23(20,21)14-8-6-12(17)7-9-14/h6-9,13H,4-5,10-11H2,1-3H3
InChI key:InChIKey=VTSDPEQAQFCJGZ-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)C1=CC=C(Cl)C=C1)C2N(C(OC(C)(C)C)=O)CCC2
Synonyms:- 1,1-Dimethylethyl 2-[[(4-chlorophenyl)sulfonyl]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 2-[[(4-chlorophenyl)sulfonyl]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 2-(((4-chlorophenyl)sulfonyl)methyl)pyrrolidine-1-carboxylate
CAS:Formula:C16H22ClNO4SMolecular weight:359.8682
