CymitQuimica logo

CAS 1353945-89-7

:

2-Chloro-N-[2-(2-furanyl)-2-oxoethyl]-N-(1-methylethyl)acetamide

Description:
2-Chloro-N-[2-(2-furanyl)-2-oxoethyl]-N-(1-methylethyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, a furan ring, and an acetamide functional group. The presence of the furan moiety contributes to its potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions and can exhibit pharmacological properties. The compound features a chloro substituent, which can enhance its electrophilic character, making it suitable for further chemical modifications. Additionally, the isopropyl group (1-methylethyl) attached to the nitrogen atom may influence its steric properties and solubility. This compound is likely to be of interest in medicinal chemistry and drug development due to its structural features that may interact with biological targets. Its specific applications and biological activities would depend on further studies, including its synthesis, stability, and interaction with other molecules. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of the chloro group.
Formula:C11H14ClNO3
InChI:InChI=1S/C11H14ClNO3/c1-8(2)13(11(15)6-12)7-9(14)10-4-3-5-16-10/h3-5,8H,6-7H2,1-2H3
InChI key:InChIKey=BPJBKWPKJBPLJK-UHFFFAOYSA-N
SMILES:N(CC(=O)C1=CC=CO1)(C(CCl)=O)C(C)C
Synonyms:
  • 2-Chloro-N-[2-(2-furanyl)-2-oxoethyl]-N-(1-methylethyl)acetamide
  • Acetamide, 2-chloro-N-[2-(2-furanyl)-2-oxoethyl]-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.