CAS 1353946-18-5

2-(Bromomethyl)-1-pyrrolidineacetic acid

Description:

2-(Bromomethyl)-1-pyrrolidineacetic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a bromomethyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile intermediate in organic synthesis. The presence of the bromomethyl group suggests it may participate in nucleophilic substitution reactions, while the carboxylic acid functionality can engage in acid-base reactions and form esters or amides. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyrrolidine moiety's biological relevance. Additionally, the compound's solubility and reactivity can be influenced by the presence of the bromine atom, which can affect its interaction with other chemical species. Overall, 2-(Bromomethyl)-1-pyrrolidineacetic acid is a compound of interest for researchers exploring new synthetic pathways and potential therapeutic agents.

Formula: C₇H₁₂BrNO₂

InChI: InChI=1S/C7H12BrNO2/c8-4-6-2-1-3-9(6)5-7(10)11/h6H,1-5H2,(H,10,11)

InChI key: InChIKey=BZJAJVKNMILRSH-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(CBr)CCC1

Synonyms:

• 2-(Bromomethyl)-1-pyrrolidineacetic acid
• 1-Pyrrolidineacetic acid, 2-(bromomethyl)-