CAS 1353946-25-4

1,1-Dimethylethyl 2-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 2-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1353946-25-4, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups such as an amine and an ester. This compound is likely to exhibit properties typical of amides and esters, including moderate solubility in organic solvents and potential reactivity towards nucleophiles due to the presence of the chloroacetyl group. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological systems. Additionally, the compound may possess pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature review for precise information. Overall, this compound represents a class of molecules that could be explored for various applications, including drug development and chemical synthesis.

Formula: C₁₅H₂₇ClN₂O₃

InChI: InChI=1S/C15H27ClN2O3/c1-11(2)18(13(19)9-16)10-12-7-6-8-17(12)14(20)21-15(3,4)5/h11-12H,6-10H2,1-5H3

InChI key: InChIKey=VJFNJTPITWGWGI-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C(C)C)C1N(C(OC(C)(C)C)=O)CCC1

Synonyms:

• 1,1-Dimethylethyl 2-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 2-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-, 1,1-dimethylethyl ester