CAS 1353946-33-4

1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-pyrrolidinecarboxylate, identified by its CAS number 1353946-33-4, is a chemical compound that features a complex structure incorporating a pyrrolidine ring, a cyclopropyl group, and a chloroacetyl moiety. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in medicinal chemistry. The presence of the dimethyl group contributes to its steric properties, potentially influencing its reactivity and solubility. Additionally, the chloroacetyl group may enhance its electrophilic character, which could be relevant in various chemical reactions. The compound's molecular structure suggests it may exhibit unique pharmacological properties, warranting further investigation in drug development contexts. As with many synthetic organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions are essential when working with this substance due to its potential biological activity and chemical reactivity.

Formula: C₁₄H₂₃ClN₂O₃

InChI: InChI=1S/C14H23ClN2O3/c1-14(2,3)20-13(19)16-7-6-11(9-16)17(10-4-5-10)12(18)8-15/h10-11H,4-9H2,1-3H3

InChI key: InChIKey=ODYROOPAJLQDKX-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)(C1CN(C(OC(C)(C)C)=O)CC1)C2CC2

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-[(2-chloroacetyl)cyclopropylamino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[(2-chloroacetyl)cyclopropylamino]-1-pyrrolidinecarboxylate