CAS 1353946-35-6
:N-[4-[[(4-Methylphenyl)sulfonyl]oxy]cyclohexyl]glycine
Description:
N-[4-[[(4-Methylphenyl)sulfonyl]oxy]cyclohexyl]glycine, identified by its CAS number 1353946-35-6, is a chemical compound that features a glycine backbone modified with a cyclohexyl group and a sulfonyl moiety. This compound is characterized by its sulfonate ester functional group, which enhances its solubility and reactivity. The presence of the 4-methylphenyl group contributes to its hydrophobic characteristics, while the cyclohexyl ring adds steric bulk, potentially influencing its biological activity and interaction with receptors. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural features suggest potential applications in areas such as anti-inflammatory or analgesic therapies, although specific biological activities would require empirical investigation. Overall, the unique combination of functional groups and structural elements in this compound makes it a subject of interest in chemical research and drug development.
Formula:C15H21NO5S
InChI:InChI=1S/C15H21NO5S/c1-11-2-8-14(9-3-11)22(19,20)21-13-6-4-12(5-7-13)16-10-15(17)18/h2-3,8-9,12-13,16H,4-7,10H2,1H3,(H,17,18)
InChI key:InChIKey=PLDWMHYCOWQGCO-UHFFFAOYSA-N
SMILES:S(OC1CCC(NCC(O)=O)CC1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- Glycine, N-[4-[[(4-methylphenyl)sulfonyl]oxy]cyclohexyl]-
- N-[4-[[(4-Methylphenyl)sulfonyl]oxy]cyclohexyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.