CAS 1353946-74-3
:2-Chloro-N-(1-methylethyl)-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
Description:
2-Chloro-N-(1-methylethyl)-N-[1-(phenylmethyl)-3-piperidinyl]acetamide, with the CAS number 1353946-74-3, is a synthetic organic compound characterized by its complex structure, which includes a chloro substituent, an isopropyl group, and a piperidine moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its piperidine structure, which is often found in pharmacologically active compounds. The presence of the chloro group can influence its reactivity and interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature reference for precise values. Overall, this compound represents a class of molecules that may exhibit interesting pharmacological properties, warranting further investigation in drug development contexts.
Formula:C17H25ClN2O
InChI:InChI=1S/C17H25ClN2O/c1-14(2)20(17(21)11-18)16-9-6-10-19(13-16)12-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13H2,1-2H3
InChI key:InChIKey=OOUSTUBRGWCJNN-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)(C(C)C)C1CN(CC2=CC=CC=C2)CCC1
Synonyms:- 2-Chloro-N-(1-methylethyl)-N-[1-(phenylmethyl)-3-piperidinyl]acetamide
- Acetamide, 2-chloro-N-(1-methylethyl)-N-[1-(phenylmethyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.