CAS 1353946-95-8
:2-[(1-Methyl-3-piperidinyl)methoxy]ethanamine
Description:
2-[(1-Methyl-3-piperidinyl)methoxy]ethanamine, identified by its CAS number 1353946-95-8, is a chemical compound that features a piperidine ring substituted with a methoxy group and an ethanamine moiety. This compound is characterized by its structural complexity, which includes a nitrogen-containing heterocyclic ring, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As an amine, it may exhibit basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the piperidine's common use in drug design. Additionally, its solubility and stability in different solvents can vary, impacting its formulation and delivery in therapeutic contexts. Overall, 2-[(1-Methyl-3-piperidinyl)methoxy]ethanamine represents a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-11-5-2-3-9(7-11)8-12-6-4-10/h9H,2-8,10H2,1H3
InChI key:InChIKey=DEMOVFGQZWVUJD-UHFFFAOYSA-N
SMILES:C(OCCN)C1CN(C)CCC1
Synonyms:- 2-[(1-Methyl-3-piperidinyl)methoxy]ethanamine
- Ethanamine, 2-[(1-methyl-3-piperidinyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.