CAS 1353947-05-3

2-[(1-Methyl-3-pyrrolidinyl)methoxy]acetic acid

Description:

2-[(1-Methyl-3-pyrrolidinyl)methoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a methoxy group attached to an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The pyrrolidine ring contributes to its cyclic structure, which can influence its reactivity and interaction with biological systems. The methoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its specific stereochemistry and functional groups may impart unique biological activities, making it a candidate for further research in drug development and therapeutic applications. As with many chemical substances, safety and handling precautions should be observed, given its potential biological activity.

Formula: C₈H₁₅NO₃

InChI: InChI=1S/C8H15NO3/c1-9-3-2-7(4-9)5-12-6-8(10)11/h7H,2-6H2,1H3,(H,10,11)

InChI key: InChIKey=HUQIWINFUYRJEN-UHFFFAOYSA-N

SMILES: C(OCC(O)=O)C1CCN(C)C1

Synonyms:

• Acetic acid, 2-[(1-methyl-3-pyrrolidinyl)methoxy]-
• 2-[(1-Methyl-3-pyrrolidinyl)methoxy]acetic acid