CAS 1353947-36-0
:2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-pyrrolidinyl]ethanone
Description:
2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-pyrrolidinyl]ethanone is a chemical compound characterized by its complex structure, which includes a chloro group, a ketone functional group, and a pyrrolidine ring. This compound is notable for its potential pharmacological properties, often explored in medicinal chemistry for its interactions with biological targets. The presence of the cyclopropylmethylamino moiety suggests possible applications in drug design, particularly in the development of compounds that may influence neurotransmitter systems. Its molecular structure indicates that it may exhibit specific stereochemical configurations, which can significantly affect its biological activity and binding affinity. Additionally, the compound's solubility, stability, and reactivity are influenced by the functional groups present, making it a subject of interest for further research in both synthetic and medicinal chemistry. As with many such compounds, safety and handling precautions are essential due to potential toxicity or reactivity, necessitating thorough investigation in laboratory settings.
Formula:C11H19ClN2O
InChI:InChI=1S/C11H19ClN2O/c1-13(10-2-3-10)7-9-4-5-14(8-9)11(15)6-12/h9-10H,2-8H2,1H3
InChI key:InChIKey=BMCQGISLFDBTFR-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2CN(C(CCl)=O)CC2
Synonyms:- Ethanone, 2-chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-pyrrolidinyl]-
- 2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-pyrrolidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.