CAS 1353947-43-9
:N1-[(2-Chloro-5-thiazolyl)methyl]-N1-cyclopropyl-1,2-ethanediamine
Description:
N1-[(2-Chloro-5-thiazolyl)methyl]-N1-cyclopropyl-1,2-ethanediamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a cyclopropyl group. The presence of the 2-chloro substituent on the thiazole enhances its reactivity and potential biological activity. This compound is classified as an amine due to the presence of two amine functional groups in its ethanediamine backbone. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, depending on its specific interactions with the solvent molecules. The compound's thiazole moiety is known for its role in various biological activities, making it of interest in medicinal chemistry. Additionally, the cyclopropyl group can influence the compound's pharmacokinetics and pharmacodynamics, potentially affecting its binding affinity to biological targets. Overall, this compound's unique structure suggests potential applications in drug development, particularly in the search for new therapeutic agents.
Formula:C9H14ClN3S
InChI:InChI=1S/C9H14ClN3S/c10-9-12-5-8(14-9)6-13(4-3-11)7-1-2-7/h5,7H,1-4,6,11H2
InChI key:InChIKey=SYGYLJOMLNRXKT-UHFFFAOYSA-N
SMILES:N(CC1=CN=C(Cl)S1)(CCN)C2CC2
Synonyms:- 1,2-Ethanediamine, N1-[(2-chloro-5-thiazolyl)methyl]-N1-cyclopropyl-
- N1-[(2-Chloro-5-thiazolyl)methyl]-N1-cyclopropyl-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.