CymitQuimica logo

CAS 1353947-51-9

:

3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid

Description:
3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid, identified by its CAS number 1353947-51-9, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a cyclopropylmethylamino group. This compound is classified as an amino acid derivative, which suggests potential biological activity, particularly in the context of neurotransmitter modulation or receptor interaction. The presence of the cyclopropyl group may impart specific steric and electronic properties, influencing its pharmacological profile. Additionally, the carboxylic acid functional group in the structure indicates that it can participate in acid-base reactions, potentially affecting its solubility and reactivity in various environments. The compound's molecular interactions could be of interest in medicinal chemistry, particularly for developing therapeutic agents targeting neurological or psychiatric conditions. Overall, the unique combination of functional groups and ring structures in this compound suggests a complex behavior that warrants further investigation in both synthetic and biological contexts.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-12(10-2-3-10)6-9-4-5-13(7-9)8-11(14)15/h9-10H,2-8H2,1H3,(H,14,15)
InChI key:InChIKey=LHSFHHQBDTZITQ-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2CN(CC(O)=O)CC2
Synonyms:
  • 1-Pyrrolidineacetic acid, 3-[(cyclopropylmethylamino)methyl]-
  • 3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.